1-N-Cbz-3-pyrrolidinone
Catalog No: FT-0630056
CAS No: 130312-02-6
- Chemical Name: 1-N-Cbz-3-pyrrolidinone
- Molecular Formula: C12H13NO3
- Molecular Weight: 219.24
- InChI Key: LMHWEUQNJRXMCD-UHFFFAOYSA-N
- InChI: InChI=1S/C12H13NO3/c14-11-6-7-13(8-11)12(15)16-9-10-4-2-1-3-5-10/h1-5H,6-9H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 219.236 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 130312-02-6 |
| Bolling_Point: | 370.2±42.0 °C at 760 mmHg |
| Product_Name: | Benzyl 3-oxopyrrolidine-1-carboxylate |
| Melting_Point: | 45-47ºC |
| Flash_Point: | 177.7±27.9 °C |
| MF: | C12H13NO3 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 0.64 |
| Flash_Point: | 177.7±27.9 °C |
| Melting_Point: | 45-47ºC |
| FW: | 219.236 |
| PSA: | 46.61000 |
| Exact_Mass: | 219.089539 |
| MF: | C12H13NO3 |
| Bolling_Point: | 370.2±42.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Refractive_Index: | 1.574 |
| Hazard_Codes: | Xn: Harmful; |
|---|---|
| Warning_Statement: | P281 |
| Risk_Statements(EU): | R22;R40 |
| Safety_Statements: | S23-S24/25-S36/37 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)